![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[IMG]](/icons/image2.gif){kind=icon}
![[VID]](/icons/movie.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
![[ ]](/icons/compressed.gif){kind=icon}
![[TXT]](/icons/text.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 0001_mosaic_32.png | 2018-06-14 15:19 | 12M | |
| 26 H638 CH PP B2B 0...> | 2018-06-14 15:19 | 96M | |
| 1977_Marc_and_Sperli..> | 2018-06-14 15:19 | 2.2M | |
| 92724_BeamShiftIssue/ | 2021-09-13 07:20 | - | |
| @eaDir/ | 2024-12-10 16:54 | - | |
| BWJONES.gif | 2018-06-14 15:20 | 51K | |
| BWJONES_Best2.gif | 2018-06-14 15:20 | 3.4K | |
| BWJones.jpg | 2018-06-14 15:20 | 45K | |
| BWJonesDissertation_..> | 2018-06-14 15:20 | 269M | |
| BWJonesDissertation_..> | 2018-06-14 15:20 | 269M | |
| BWJonesDissertation_..> | 2018-06-14 15:20 | 14M | |
| BWJones_Screenshots/ | 2018-06-14 15:20 | - | |
| Baehr Lab/ | 2025-05-19 18:48 | - | |
| Black Line/ | 2021-04-23 10:45 | - | |
| Blog images/ | 2024-09-30 17:21 | - | |
| Blog movies/ | 2024-09-30 17:30 | - | |
| Bruchs Membrane.jpg | 2018-06-14 15:20 | 805K | |
| Corrected Proof 11-0..> | 2018-06-14 15:20 | 10M | |
| DKO Mouse.zip | 2018-06-14 15:20 | 248M | |
| DMImages/ | 2021-08-10 16:26 | - | |
| DissertationFINALMOD..> | 2018-06-14 15:20 | 269M | |
| Drug-dog-alert.gif | 2018-06-14 15:20 | 6.8M | |
| For Allen Taylor/ | 2021-02-26 18:07 | - | |
| For Anna and Mark/ | 2023-04-13 16:35 | - | |
| For Barb Rohrer/ | 2025-04-01 15:11 | - | |
| For Brittany/ | 2020-09-17 16:05 | - | |
| For Gabe/ | 2021-12-03 15:13 | - | |
| For Gatan/ | 2023-06-15 14:59 | - | |
| For ISER 2024 Photos..> | 2024-12-10 16:52 | 344M | |
| For ISER 2024 Photos/ | 2024-12-10 16:49 | - | |
| For James and Pete/ | 2024-02-14 08:38 | - | |
| For Jonathan and Gaya / | 2020-09-16 13:43 | - | |
| For Karolinska/ | 2024-02-28 11:01 | - | |
| For Katherine/ | 2018-06-14 16:24 | - | |
| For Kris and Henri/ | 2021-10-07 16:26 | - | |
| For Kyle/ | 2021-05-07 16:10 | - | |
| For Linda Bult/ | 2018-06-14 16:27 | - | |
| For Maureen/ | 2019-03-01 14:47 | - | |
| For Occelli/ | 2018-06-14 16:40 | - | |
| For Print Services/ | 2023-07-12 10:33 | - | |
| For Robert/ | 2018-06-14 16:40 | - | |
| For Sonja Deffner/ | 2023-04-10 13:06 | - | |
| For Tiffany/ | 2020-09-21 10:19 | - | |
| For Valle_Doyle/ | 2024-11-01 16:57 | - | |
| Golgi focus stack.tif | 2018-06-14 16:40 | 399M | |
| Ground Squirrel/ | 2018-06-14 16:41 | - | |
| Jackling House Terms..> | 2018-06-14 16:41 | 3.7M | |
| Jianhai Du Laboratory/ | 2021-12-20 17:08 | - | |
| Jones_JCN_2003.pdf | 2018-06-14 16:41 | 4.8M | |
| LASIK_Movie.avi | 2018-06-14 16:41 | 199M | |
| LASIK_Movie.mp4 | 2018-06-14 16:41 | 28M | |
| LGR5_GFP7483 / | 2018-06-14 16:42 | - | |
| LGR5_GFP7484/ | 2018-06-14 16:42 | - | |
| Lead_Tissue_Fox/ | 2018-06-14 16:41 | - | |
| Marclab Website/ | 2018-08-03 16:11 | - | |
| Model/ | 2018-06-14 16:43 | - | |
| Moran Directions.jpg | 2018-06-14 16:43 | 1.0M | |
| Organoids/ | 2025-06-12 13:46 | - | |
| PHYS3110/ | 2018-06-14 16:43 | - | |
| PbPanels/ | 2018-06-14 16:43 | - | |
| Robots.txt | 2018-06-14 16:43 | 27 | |
| Rohrer data/ | 2018-06-14 16:44 | - | |
| Small World Retina.avi | 2018-06-14 16:44 | 695M | |
| Smoked_Retina_WT_CfB..> | 2018-06-14 16:44 | 162M | |
| Springer Chapter/ | 2018-06-14 16:44 | - | |
| TEM1_PostSEM_Update.tif | 2023-04-17 12:07 | 3.0G | |
| TEM examples/ | 2018-06-14 16:44 | - | |
| Western Scrub Jay.MOV | 2018-06-14 16:44 | 42M | |
| baby tapir.jpg | 2018-06-14 15:19 | 19K | |
| babyturtle.jpg | 2018-06-14 15:19 | 86K | |
| dark quadrant.mrc | 2018-06-14 15:20 | 32M | |
| dark quadrant.tif | 2018-06-14 15:20 | 24M | |
| jones-1.pdf | 2018-06-14 16:41 | 4.8M | |
| panels/ | 2018-06-14 16:43 | - | |